![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | WildFarmed standards 2025.pdf | 2026-01-25 11:08 | 281K | |
![[ ]](/icons/layout.gif) | rhizosphere dwarf influence.pdf | 2025-12-13 06:47 | 1.2M | |
![[ ]](/icons/layout.gif) | rhizosphere deterioration in modern wheat.pdf | 2025-12-13 06:46 | 1.7M | |
![[ ]](/icons/layout.gif) | wheat landraces in farmers fields Turkey.pdf | 2025-10-07 09:08 | 8.2M | |
![[ ]](/icons/layout.gif) | A New Perspective on Medieval and Early Modern Agriculture_Six Centuries of Norfolk Farming 1250-1850.pdf | 2025-09-13 10:28 | 4.7M | |
![[ ]](/icons/layout.gif) | WILDFARMED REGENERATIVE STANDARDS.pdf | 2025-09-11 09:00 | 6.9M | |
![[ ]](/icons/layout.gif) | Classification des blés tendres France - 1951 - Jonard.pdf | 2025-09-09 14:40 | 7.5M | |
![[ ]](/icons/layout.gif) | Supplément_aux_'Meilleurs_blés' P Vilmorin 1909.pdf | 2025-08-17 10:40 | 25M | |
![[ ]](/icons/layout.gif) | New flavors from old wheats_exploring the aroma profiles and sensory attributes of local Mediterranean wheat landraces.pdf | 2025-07-25 07:19 | 5.7M | |
![[ ]](/icons/layout.gif) | The Israeli–Palestinian wheat landraces collection_restoration and characterization of lost genetic diversity.pdf | 2025-07-25 07:18 | 1.7M | |
![[ ]](/icons/layout.gif) | UK_cereals_1760_1930.pdf | 2025-07-21 20:21 | 2.8M | |
![[ ]](/icons/layout.gif) | Mycorrhizal dependence of modern wheat cultivars and ancestors - a synthesis.pdf | 2025-06-17 11:17 | 482K | |
![[ ]](/icons/layout.gif) | Plant Food Processing Tools at Gobekli Tepe.pdf | 2025-06-08 11:32 | 50M | |
![[ ]](/icons/layout.gif) | the anceint carb revolution - early cereals in the diet pre farming.pdf | 2025-06-08 11:29 | 699K | |
![[ ]](/icons/layout.gif) | Mycorrhizal dependence of modern wheat varieties, landraces, and ancestors.pdf | 2025-06-03 11:26 | 600K | |
![[ ]](/icons/layout.gif) | Peachey. 1951. Cereals Varieties in Great Britain_2.pdf | 2025-05-16 15:50 | 65M | |
![[ ]](/icons/layout.gif) | Wheat in Great Britain - John Percival.pdf | 2025-03-05 08:53 | 34M | |
![[ ]](/icons/layout.gif) | landraces_and_improved_varieties_of_bread_wheat_Netherlands_Zeven.pdf | 2025-02-06 00:19 | 2.5M | |
![[ ]](/icons/layout.gif) | Competitiveness of the British Cereals Sector 1760-1930.pdf | 2025-02-04 13:13 | 2.8M | |
![[DIR]](/icons/folder.gif) | vilmorin_bup/ | 2025-02-04 12:37 | - | |
![[DIR]](/icons/folder.gif) | images/ | 2025-02-04 12:36 | - | |
![[ ]](/icons/unknown.gif) | Pages from Les-bles-tendres-cultives Nord Pas de Calais 1800 - 1930 essay.doc | 2025-02-04 12:27 | 882K | |
![[TXT]](/icons/text.gif) | Pages from Les-bles-tendres-cultives Nord Pas de Calais 1800 - 1930 essay.html | 2025-02-04 12:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Pages from Les-bles-tendres-cultives Nord Pas de Calais 1800 - 1930 essay.pdf | 2025-02-04 12:13 | 293K | |
![[ ]](/icons/layout.gif) | Vilmorin_epi_carre.pdf | 2025-02-03 10:26 | 225K | |
![[ ]](/icons/layout.gif) | Les_Meilleurs_blés_Vilmorin_reduce.pdf | 2025-02-03 10:23 | 35M | |
![[ ]](/icons/layout.gif) | Arbuscular mycorrhiza in landrace.pdf | 2025-01-29 23:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Identification of a new class of recombinant (Bankuti 1201).pdf | 2025-01-27 21:40 | 480K | |
![[ ]](/icons/layout.gif) | Inspired individuals and charismatic leaders_Clare.pdf | 2025-01-01 09:07 | 3.9M | |
![[ ]](/icons/layout.gif) | Geographic Distribution of Common and Dwarf Bunt Resistance in Landraces Wheat.pdf | 2024-12-12 15:55 | 386K | |
![[ ]](/icons/layout.gif) | Zeven. 14,000 wheat geneologies_cropped.pdf | 2024-12-12 00:07 | 30M | |
![[ ]](/icons/layout.gif) | Journal_of_the_Royal_Agricultural_Societ_1889.pdf | 2024-12-12 00:06 | 35M | |
![[ ]](/icons/layout.gif) | Volume_16_Part_1__1988.pdf | 2024-12-11 23:53 | 4.4M | |
![[ ]](/icons/layout.gif) | Volume_16_Part_2__1988.pdf | 2024-12-11 23:51 | 2.7M | |
![[ ]](/icons/layout.gif) | British_Farming_a_Description_of_1862.pdf | 2024-12-11 20:32 | 15M | |
![[ ]](/icons/layout.gif) | Classification_of_American_Wheat_Varieties_Clark_1922.pdf | 2024-12-11 20:27 | 10M | |
![[ ]](/icons/layout.gif) | UKCPVS Annual Report 1983.pdf | 2024-12-11 20:24 | 6.1M | |
![[ ]](/icons/layout.gif) | UKCPVS Annual Report 1982.pdf | 2024-12-11 20:23 | 6.4M | |
![[ ]](/icons/layout.gif) | UKCPVS Annual Report 1986.pdf | 2024-12-11 20:23 | 5.1M | |
![[ ]](/icons/layout.gif) | Om_landbrugets_kulturplanter_8_1890_shirriffs_squarehead_in_denmark.pdf | 2024-12-05 11:47 | 3.2M | |
![[ ]](/icons/layout.gif) | Diverse Wheat-Alien Introgression Lines as a Basis for Durable Resistance and Quality Characteristics in Bread Wheat.pdf | 2024-11-28 21:41 | 1.2M | |
![[ ]](/icons/layout.gif) | Les-bles-tendres-cultives Nord Pas de Calais 1800 - 1930.pdf | 2024-11-19 18:33 | 2.9M | |
![[ ]](/icons/layout.gif) | rough translation - shirrefs sqaurehead to Denmark 1874.pdf | 2024-11-19 18:18 | 160K | |
![[ ]](/icons/layout.gif) | bedő-et-al-2017-breeding-for-adaptation-traits-of-wheat-in-eastern-european-environments-the-hungarian-example.pdf | 2024-11-19 17:58 | 651K | |
![[ ]](/icons/layout.gif) | 1949_Flandrin_Les_varietes_anciennes_de_bles.pdf | 2024-11-19 16:15 | 1.7M | |
![[ ]](/icons/layout.gif) | 1949_Flandrin_pedigree bleės anciens_A0.pdf | 2024-11-19 16:15 | 823K | |
![[ ]](/icons/layout.gif) | Bunt and Smut Diseases of Wheat - CIMMYT.pdf | 2024-11-18 17:55 | 3.3M | |
![[ ]](/icons/layout.gif) | Shirrefs squarehead to denmark 1874 _extract.pdf | 2024-11-18 12:55 | 2.6M | |
![[ ]](/icons/layout.gif) | Unlocking the genetic diversity of Mexican Creole wheats.pdf | 2024-10-12 08:52 | 1.3M | |
![[ ]](/icons/layout.gif) | Mexican Creole cereals.pdf | 2024-10-12 08:17 | 1.3M | |
![[ ]](/icons/layout.gif) | BLE DUR en France_translation.pdf | 2024-10-01 09:48 | 9.8M | |
![[ ]](/icons/layout.gif) | BLE DUR en France.pdf | 2024-10-01 07:34 | 4.0M | |
![[ ]](/icons/layout.gif) | borlaug1968_wheat_breeding.pdf | 2024-09-27 09:06 | 2.1M | |
![[ ]](/icons/layout.gif) | Le Blé meunier d’Apt_translation.pdf | 2024-09-24 12:33 | 2.9M | |
![[ ]](/icons/layout.gif) | Les-bles-tendres-cultives Nord Pas de Calais 1800 - 1930_translation.pdf | 2024-09-24 12:25 | 7.1M | |
![[ ]](/icons/layout.gif) | CIMMYT - Indian multilines.pdf | 2024-08-30 20:09 | 3.5M | |
![[ ]](/icons/layout.gif) | plant_wheat_teachers.pdf | 2024-08-15 21:17 | 3.8M | |
![[ ]](/icons/layout.gif) | williamjfarrerr.pdf | 2024-08-15 11:35 | 2.6M | |
![[ ]](/icons/layout.gif) | Analysis of the Quality Traits of a Bankuti 1201 Population.pdf | 2024-07-29 13:09 | 243K | |
![[ ]](/icons/layout.gif) | Rapport BLE POP 2021.pdf | 2024-07-22 11:33 | 2.0M | |
![[ ]](/icons/layout.gif) | Harnessing Landrace Diversity Empowers Wheat Breeding for Climate Resilience _ bioRxiv.pdf | 2024-07-02 09:25 | 2.5M | |
![[ ]](/icons/layout.gif) | Breeding for breadmaking quality using old Hungarian wheat varieties.pdf | 2024-06-07 21:30 | 22K | |
![[ ]](/icons/layout.gif) | Bankuti 1201 - An old Hungarian wheat variety with special storage protein composition.pdf | 2024-06-07 08:11 | 236K | |
![[ ]](/icons/layout.gif) | Protein heterogeneity in European wheat landraces and obsolete cultivars.pdf | 2024-06-05 09:42 | 236K | |
![[ ]](/icons/layout.gif) | The Gluten Composition of Wheat Varieties and Genotypes HMW subunits.pdf | 2024-05-28 11:07 | 1.5M | |
![[ ]](/icons/layout.gif) | EXCAVATIONS IN THE MUGHARET EL-KEBARAH.pdf | 2024-05-22 21:40 | 2.3M | |
![[ ]](/icons/layout.gif) | 14000 year old hunter gatherer toolkit.pdf | 2024-05-22 20:40 | 3.8M | |
![[ ]](/icons/layout.gif) | The Garbage Crisis in prehistory - artefact discard patterns in the early Natufian.pdf | 2024-05-22 19:48 | 15M | |
![[ ]](/icons/layout.gif) | Gobekli Tep - a 6th C BC monument.pdf | 2024-05-21 23:42 | 5.8M | |
![[ ]](/icons/layout.gif) | High Buffering Potential of Winter Wheat Composite Cross.pdf | 2024-05-20 10:57 | 2.5M | |
![[ ]](/icons/layout.gif) | gobekli_feasting.pdf | 2024-05-17 23:50 | 6.1M | |
![[ ]](/icons/layout.gif) | Nimrods piscators pluckers and planters_The emergence of food production.pdf | 2024-05-16 15:45 | 3.4M | |
![[ ]](/icons/layout.gif) | Persistent_Controversies_about_the_Neolithic.pdf | 2024-05-16 15:17 | 393K | |
![[ ]](/icons/layout.gif) | BreadPresidia.pdf | 2024-04-06 22:04 | 20M | |
![[ ]](/icons/layout.gif) | karnal_bunt.pdf | 2024-03-30 07:58 | 1.5M | |
![[ ]](/icons/layout.gif) | Evolution of bread-making quality of Spanish bread-wheat genotypes.pdf | 2024-02-23 19:49 | 591K | |
![[ ]](/icons/layout.gif) | Genetic variability assessment of 127 Triticum turgidum L. accessions for mycorrhizal susceptibility-related traits detection.pdf | 2024-02-06 08:54 | 1.4M | |
![[ ]](/icons/layout.gif) | Management Practices and Breeding History of Varieties Strongly Determine the Fine Genetic Structure of Crop Populations_A Case Study Based on European Wheat Populations.pdf | 2024-01-28 10:59 | 1.0M | |
![[ ]](/icons/layout.gif) | Diversity trends in bread wheat in Italy during the 20th century assessed by traditional and multivariate approaches.pdf | 2024-01-28 09:11 | 1.2M | |
![[ ]](/icons/layout.gif) | The Explosibility of Flour, Gluten and Wheat Dust.pdf | 2024-01-25 08:31 | 719K | |
![[ ]](/icons/layout.gif) | The role of gene flow and chromosomal instability in shaping the bread wheat genome.pdf | 2024-01-23 09:45 | 3.4M | |
![[ ]](/icons/layout.gif) | Entry, colonization, and distribution of endophytic microorganisms in plants.pdf | 2023-11-22 08:47 | 1.4M | |
![[ ]](/icons/layout.gif) | Rhizophagy Cycle with James White.pdf | 2023-11-21 23:51 | 3.9M | |
![[ ]](/icons/layout.gif) | The_Ruttledge_families_of_Co_Mayo.pdf | 2023-11-12 11:57 | 3.5M | |
![[ ]](/icons/layout.gif) | 20110405-Tolmers-in-Colour110405.pdf | 2023-10-16 10:56 | 4.4M | |
![[ ]](/icons/layout.gif) | Effects of breeding history and crop management on the root architecture of wheat.pdf | 2023-10-15 14:15 | 771K | |
![[ ]](/icons/layout.gif) | The Spread of Bread Wheat over the Old World since the Neolithicum as Indicated by its Genotype for Hybrid Necrosis.pdf | 2023-10-15 14:05 | 3.3M | |
![[ ]](/icons/layout.gif) | wheat-evolution-history.pdf | 2023-10-15 13:38 | 3.7M | |
![[ ]](/icons/layout.gif) | wheat growing and flour milling - Ireland 1929.pdf | 2023-10-15 08:33 | 1.8M | |
![[ ]](/icons/layout.gif) | Taxonomical classification and origin of Kamut wheat.pdf | 2023-09-25 19:42 | 765K | |
![[ ]](/icons/layout.gif) | French early 20th C wheat pedigrees_translated.pdf | 2023-08-29 07:30 | 6.8M | |
![[ ]](/icons/layout.gif) | French early 20th C wheat pedigrees.pdf | 2023-08-28 07:41 | 1.7M | |
![[ ]](/icons/layout.gif) | Farmer Seed Exchange and Crop Diversity in a Changing Agricultural Landscape in the Southern Highlands of Ethiopia.pdf | 2023-07-25 14:33 | 236K | |
![[ ]](/icons/layout.gif) | Harvest Security and Intraspecific Diversity in Traditional Tropical Agriculture.pdf | 2023-07-25 12:04 | 468K | |
![[ ]](/icons/layout.gif) | Maintenance of sorghum (sorghum bicolor, poaceae) landrace diversity by farmers’ selection in Ethiopia.pdf | 2023-07-25 10:16 | 748K | |
![[ ]](/icons/layout.gif) | caractérisation des blés de pays de Redon.pdf | 2023-07-25 09:00 | 2.1M | |
![[ ]](/icons/layout.gif) | celeiac_dsisease_epitopes_modern_v_ heritage.pdf | 2023-07-17 13:53 | 1.7M | |
![[ ]](/icons/layout.gif) | Impact of Silicon on Plant Nutrition and Signifcance of Silicon mobilizing bacteria in agronomy.pdf | 2023-07-14 21:58 | 1.4M | |
![[ ]](/icons/layout.gif) | Micronutrients-and-food-choice--A-case-of--nutritional-wisdom--i_2022_Appeti.pdf | 2023-07-07 15:07 | 4.0M | |
![[ ]](/icons/layout.gif) | Essai de Classification des Blés tendres cultivés en France - 1936.pdf | 2023-07-04 12:10 | 6.7M | |
![[ ]](/icons/layout.gif) | helium_pedigree_visualisation.pdf | 2023-06-23 17:55 | 2.6M | |
![[ ]](/icons/layout.gif) | CLASSIFICATION OF AMERICAN wheat varities 1922, clark et al.pdf | 2023-06-20 01:42 | 16M | |
![[ ]](/icons/layout.gif) | Genome wide association study of resistance to the yellow rust in UK wheat.pdf | 2023-06-18 18:54 | 8.1M | |
![[ ]](/icons/layout.gif) | CIMMYT_pedigrees.pdf | 2023-06-16 17:50 | 2.2M | |
![[ ]](/icons/layout.gif) | valeriane_126_blas-anciens-ou-bles-modernes_eng.pdf | 2023-06-16 11:40 | 1.3M | |
![[ ]](/icons/layout.gif) | valeriane_126_blas-anciens-ou-bles-modernes.pdf | 2023-06-16 11:39 | 310K | |
![[ ]](/icons/layout.gif) | Evaluation of 19460 Wheat Accessions in Indian National Genebank.pdf | 2023-06-15 16:01 | 3.7M | |
![[ ]](/icons/layout.gif) | Les_Meilleurs_blés_Vilmorin.pdf | 2023-06-02 21:56 | 21M | |
![[ ]](/icons/layout.gif) | Dissemination_of_the_highly_expressed_Bx7_glutenin_subunit_Glu-B1al_allele_in_wheat_as_revealed_by_PCR.pdf | 2023-05-15 22:08 | 406K | |
![[ ]](/icons/layout.gif) | Analysis of Diversity of Russian and Ukrainian Bread Wheat.pdf | 2023-05-09 23:41 | 265K | |
![[ ]](/icons/layout.gif) | Allelic diversity of HMW and LMW glutenin subunits and omega-gliadins in French bread wheat.pdf | 2023-05-09 21:32 | 761K | |
![[ ]](/icons/layout.gif) | The HMW glutenin subunit composition of Canadian wheat cultivars and their association with bread-making quality.pdf | 2023-05-09 21:07 | 504K | |
![[ ]](/icons/layout.gif) | SP5_19._New_wheat_breeding_techniques.pdf | 2023-05-09 20:05 | 716K | |
![[ ]](/icons/layout.gif) | relationship between HMW glutenin subunit composition and bread-making quality of British-grown wheat varieties.pdf | 2023-05-09 19:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Note Sur Le Bl De No Ou Bl Bleu.pdf | 2023-04-21 18:52 | 317K | |
![[ ]](/icons/layout.gif) | Bran in bread making - a criticl review.pdf | 2023-04-11 11:43 | 1.1M | |
![[ ]](/icons/layout.gif) | wheat aleurone layer composition and uses.pdf | 2023-04-11 11:37 | 839K | |
![[ ]](/icons/layout.gif) | A_Grounded_Guide_to_Gluten_How_Modern_Genotypes.pdf | 2023-03-27 08:21 | 754K | |
![[ ]](/icons/layout.gif) | Mobilization of Micronutrients by Mycorhizal Fungi.pdf | 2023-03-25 20:51 | 458K | |
![[ ]](/icons/layout.gif) | Breeding Bread-Making Wheat Varieties for Organic Farming.pdf | 2023-03-25 09:17 | 346K | |
![[ ]](/icons/layout.gif) | Agricultural_emissions_vfinal2.pdf | 2023-03-24 23:26 | 1.5M | |
![[ ]](/icons/layout.gif) | florence_aurore_pedigree.pdf | 2023-03-03 18:35 | 2.0M | |
![[ ]](/icons/layout.gif) | Ancient Genomics of Modern Humans - the first decade.pdf | 2023-02-27 12:41 | 1.4M | |
![[ ]](/icons/layout.gif) | Good breadmaking quality wheat with Glu-D1a.pdf | 2023-02-27 08:32 | 543K | |
![[ ]](/icons/layout.gif) | tracing the Marquis wheat success story.pdf | 2023-02-05 14:40 | 562K | |
![[ ]](/icons/layout.gif) | conservation-entre-heritage-et-dynamique-site.pdf | 2023-02-05 10:14 | 11M | |
![[ ]](/icons/layout.gif) | Apocarotenoids - Old and New Mediators of the Arbuscular Mycorrhizal Symbiosis.pdf | 2022-12-17 10:35 | 1.1M | |
![[ ]](/icons/layout.gif) | Gobekli_Tepe_Turkey_A_brief_summary_of_r.pdf | 2022-12-17 08:29 | 3.4M | |
![[ ]](/icons/layout.gif) | Variation in chemical composition and physical characteristics of cereal grains from different genotypes.pdf | 2022-12-16 22:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Maintenance of sorghum landrace diversity by farmers selection in Ethiopia.pdf | 2022-12-14 11:45 | 748K | |
![[ ]](/icons/layout.gif) | Abscisic Acid Promotion of Arbuscular Mycorrhiza.pdf | 2022-12-09 09:07 | 1.5M | |
![[ ]](/icons/layout.gif) | Durum Wheat Breeding in the Mediterranean Region.pdf | 2022-12-08 20:52 | 351K | |
![[ ]](/icons/layout.gif) | The Varieties, Properties, and Classification Wheat - le Couteur.pdf | 2022-11-12 09:45 | 4.7M | |
![[ ]](/icons/layout.gif) | Moderate Decrease of pH by Sourdough Fermentation Is sufficent to reduce phytase.pdf | 2022-10-21 08:36 | 110K | |
![[ ]](/icons/layout.gif) | Minerals and their availability in flours and breads of different types of wheat.pdf | 2022-10-21 08:01 | 508K | |
![[ ]](/icons/layout.gif) | Biofortifcation and bioavailability of Zn, Fe and Se in wheat - present status and future prospects.pdf | 2022-10-20 15:31 | 2.1M | |
![[ ]](/icons/layout.gif) | Distribution of Enzymes in Wheat Flour Mill Streams.pdf | 2022-10-12 13:25 | 140K | |
![[ ]](/icons/layout.gif) | DistributionofEnzymesinWheatFlourMillStreamsprinted.pdf | 2022-10-10 10:41 | 184K | |
![[ ]](/icons/layout.gif) | Grain yield, nitrogen-use efficiency and baking quality of old and modern Italian wheats.pdf | 2022-10-08 11:11 | 428K | |
![[ ]](/icons/layout.gif) | Sensory Analyses and Nutritional Qualities of organic wheats in artisan baking - FR.pdf | 2022-10-08 09:17 | 3.6M | |
![[ ]](/icons/layout.gif) | heritage or modern spring wheat - Norway.pdf | 2022-10-08 09:04 | 1.2M | |
![[ ]](/icons/layout.gif) | P efficiencies and mycorrhizal responsiveness of old and modern wheats.pdf | 2022-10-05 08:17 | 317K | |
![[ ]](/icons/layout.gif) | Crop_processing_of_hulled_wheats.pdf | 2022-10-03 09:51 | 71K | |
![[ ]](/icons/layout.gif) | Two waves of coeliac disease incidence in Sweden.pdf | 2022-09-12 09:13 | 2.5M | |
![[ ]](/icons/layout.gif) | Final_International Field Trial Day bunt resistance.pdf | 2022-07-26 09:05 | 1.5M | |
![[ ]](/icons/layout.gif) | Constant vigilance plant functions guarded by resistance proteins.pdf | 2022-07-22 09:49 | 1.3M | |
![[ ]](/icons/layout.gif) | Molecular Mapping and Validation of SrND643.pdf | 2022-07-21 17:05 | 573K | |
![[ ]](/icons/layout.gif) | common_bunt_resistance_2012.pdf | 2022-07-14 00:15 | 187K | |
![[ ]](/icons/layout.gif) | WPBS Leaflet Series S No 5.pdf | 2022-07-10 10:05 | 6.0M | |
![[ ]](/icons/layout.gif) | Genomics_of_Wheat_the_Basis_of_Our_Daily.pdf | 2022-01-23 22:54 | 2.3M | |
![[ ]](/icons/layout.gif) | wheat_Health_2020_Borgen.pdf | 2021-09-26 20:34 | 173K | |
![[ ]](/icons/layout.gif) | Construction_four_a_bois.pdf | 2021-09-02 10:43 | 5.3M | |
![[ ]](/icons/layout.gif) | Evidence_of_decreasing_mineral_density_in_wheat.pdf | 2021-08-01 10:02 | 1.1M | |
![[ ]](/icons/layout.gif) | New insights into wheat toxicity- Breeding did not seem to contribute toa prevalence of potential celiac disease’s immunostimulatory epitopes.pdf | 2021-02-06 20:03 | 720K | |
![[ ]](/icons/layout.gif) | Improving wheat to remove coeliac epitopes but retain functionality.pdf | 2021-01-23 15:12 | 611K | |
![[ ]](/icons/layout.gif) | Historical changes in the contents and compositions of fibre components and polar metabolites in white wheat flour.pdf | 2021-01-23 13:55 | 1.6M | |
![[ ]](/icons/layout.gif) | wheat - Shewry - 2009.pdf | 2021-01-22 21:05 | 719K | |
![[ ]](/icons/layout.gif) | Profiles of phenolic compounds in modern and old common wheat varieties.pdf | 2021-01-22 16:12 | 716K | |
![[ ]](/icons/layout.gif) | Differential Physiological Responses Elicited by Ancient and Heritage Wheat Cultivars Compared to Modern Ones.pdf | 2021-01-22 15:56 | 464K | |
![[ ]](/icons/layout.gif) | Pro-Inflammatory Effect of Gliadins and Glutenins Extracted from Different Wheat Cultivars on an In Vitro 3D Intestinal Epithelium Model.pdf | 2021-01-22 15:39 | 3.3M | |
![[ ]](/icons/layout.gif) | Changing Pattern of Childhood Celiac Disease Epidemiology - Contributing Factors.pdf | 2021-01-22 15:29 | 1.0M | |
![[ ]](/icons/layout.gif) | Celiac Lesion T Cells Recognize Epitopes That Cluster inRegions of Gliadins Rich in Proline Residues.pdf | 2021-01-22 14:16 | 134K | |
![[ ]](/icons/layout.gif) | In vivo antigen challenge in celiac disease identifies a single peptide.pdf | 2021-01-22 13:52 | 271K | |
![[ ]](/icons/layout.gif) | The Intestinal T Cell Response to a-Gliadin in Adult Celiac.pdf | 2021-01-22 12:56 | 174K | |
![[ ]](/icons/layout.gif) | Nomenclature and listing of celiac disease relevant glutenT-cell epitopes.pdf | 2021-01-22 10:34 | 199K | |
![[ ]](/icons/layout.gif) | Arbuscular Mycorrhizal Associations and Their Significance for Wheat.pdf | 2021-01-12 18:19 | 560K | |
![[ ]](/icons/layout.gif) | Sensory_test_vs_electronic_nose_and_or_i.pdf | 2021-01-12 11:24 | 564K | |
![[ ]](/icons/layout.gif) | Principles_of_Cereal_Science_and_Technology.pdf | 2020-12-14 08:40 | 8.8M | |
![[ ]](/icons/layout.gif) | Biological Globalization_The Other Grain Invasion.pdf | 2020-12-10 10:04 | 198K | |
![[ ]](/icons/layout.gif) | effect-of-aging-wheat-flour-on-baked-product.pdf | 2020-12-04 23:36 | 528K | |
![[ ]](/icons/layout.gif) | Key issues and challenges in whole wheat flour milling and storage.pdf | 2020-12-04 22:36 | 428K | |
![[ ]](/icons/layout.gif) | whole wheat flour stability_an insight.pdf | 2020-12-04 20:04 | 479K | |
![[ ]](/icons/layout.gif) | Wheat_flour_constituents_how_they_impact.pdf | 2020-12-04 19:48 | 536K | |
![[ ]](/icons/layout.gif) | thesourdoughmicroflorabiodiversityandmetabolicinteractions.pdf | 2020-12-04 19:47 | 203K | |
![[ ]](/icons/layout.gif) | french wheats jonnard 1951.pdf | 2020-09-29 21:33 | 5.6M | |
![[ ]](/icons/layout.gif) | french wheats jonnard 1936.pdf | 2020-09-29 21:32 | 5.7M | |
![[ ]](/icons/layout.gif) | Sur quelques bles traditionnels du sud-est de la France.pdf | 2020-09-15 09:26 | 1.3M | |
![[ ]](/icons/layout.gif) | Understanding Global Trends in the Use of Wheat - CIMMYT.pdf | 2020-08-30 06:48 | 552K | |
![[ ]](/icons/layout.gif) | Tackling the re-emergence of wheat stem rust.pdf | 2020-08-29 13:44 | 307K | |
![[ ]](/icons/layout.gif) | wheat types grown in the Netherlands up to 1944 - Zeven.pdf | 2020-08-14 09:06 | 3.7M | |
![[ ]](/icons/layout.gif) | Changes in Milling Properties of Newly Harvested Hard Wheat During Storage.pdf | 2020-08-11 07:25 | 578K | |
![[ ]](/icons/layout.gif) | Astrié by astrie brothers.pdf | 2020-07-20 16:59 | 2.6M | |
![[ ]](/icons/layout.gif) | early_neolithic_agriculture_in_Iberian_peninsula.pdf | 2020-07-14 10:41 | 1.2M | |
![[ ]](/icons/layout.gif) | Crop-processing_of_hulled_wheats.pdf | 2020-07-04 15:05 | 68K | |
![[ ]](/icons/layout.gif) | windrow_scythe_article.pdf | 2020-06-30 21:06 | 901K | |
![[ ]](/icons/layout.gif) | Bankuti_1201_gluten_study.pdf | 2020-06-22 22:32 | 419K | |
![[ ]](/icons/layout.gif) | Unusually_High_Incidence_of_Paediatric_Coeliac_Disease_in_Sweden.pdf | 2020-06-02 09:54 | 713K | |
![[ ]](/icons/layout.gif) | wheat_innovation_19th_20th.pdf | 2020-05-06 06:46 | 885K | |
![[ ]](/icons/layout.gif) | sort by color and surface texture USDA.pdf | 2019-11-24 17:17 | 4.6M | |
![[ ]](/icons/layout.gif) | agricututral and soils Kent, Sussex, Surrey - KOH.pdf | 2019-08-10 19:01 | 466K | |
![[ ]](/icons/layout.gif) | Genome-wide patterns of selection in Eurasians - cf CD.pdf | 2019-06-17 10:23 | 2.6M | |
![[ ]](/icons/layout.gif) | From the Neolithic Revolution to Gluten Intolerance_ Benefit...pdf | 2019-06-17 08:32 | 168K | |
![[ ]](/icons/layout.gif) | nordic_orange_wheat_blossom_midge.pdf | 2019-05-17 19:02 | 2.9M | |
![[IMG]](/icons/image2.gif) | Mulika_local_view.png | 2019-05-15 10:48 | 55K | |
![[IMG]](/icons/image2.gif) | Mulika_local_view_all.png | 2019-05-15 10:46 | 288K | |
![[ ]](/icons/layout.gif) | UK_wheat_SNP_Dendrogram.pdf | 2019-05-15 08:56 | 12K | |
![[ ]](/icons/layout.gif) | Season and region of birth as risk factors for coeliac.pdf | 2019-05-04 11:58 | 414K | |
![[ ]](/icons/layout.gif) | Towards Explaining the Swedish epidemic of celiac disease.pdf | 2019-04-29 14:36 | 1.9M | |
![[ ]](/icons/layout.gif) | Analysis of the Distribution of Triticum timopheevii.pdf | 2019-04-29 12:10 | 68K | |
![[ ]](/icons/layout.gif) | humans eating cereals, benefits, problems and solutions.pdf | 2019-04-26 12:52 | 4.0M | |
![[ ]](/icons/layout.gif) | vilmorin_ble_1925.pdf | 2019-04-26 09:37 | 620K | |
![[ ]](/icons/layout.gif) | Om_landbrugets_kulturplanter_8_1890_Shirriffs_Squarehead edit.pdf | 2019-04-25 10:56 | 2.5M | |
![[ ]](/icons/layout.gif) | Journal_d'agriculture_pratique_de_jardinage_1886_shirreffs_squarehead.pdf | 2019-04-20 19:56 | 959K | |
![[ ]](/icons/layout.gif) | are ancient wheats different.pdf | 2019-04-09 11:34 | 485K | |
![[ ]](/icons/layout.gif) | stem_rust_resistance_from_emmer.pdf | 2019-04-07 22:24 | 794K | |
![[ ]](/icons/layout.gif) | do ancient wheats have a benefit.pdf | 2019-04-07 22:16 | 9.5M | |
![[ ]](/icons/layout.gif) | synthetic hexaploid wheat history.pdf | 2019-04-06 15:54 | 407K | |
![[ ]](/icons/layout.gif) | Olivera Emmer stem rust resistance.pdf | 2019-04-06 15:53 | 551K | |
![[ ]](/icons/layout.gif) | re-synthesis of wheat.pdf | 2019-04-05 21:30 | 1.7M | |
![[ ]](/icons/layout.gif) | Georgian Wheat.pdf | 2019-04-01 10:28 | 554K | |
![[ ]](/icons/layout.gif) | Indian_CIMMYT_1994.pdf | 2019-01-12 20:54 | 2.9M | |
![[ ]](/icons/layout.gif) | classification of USA land race wheats_ Zeven.pdf | 2019-01-06 21:27 | 318K | |
![[ ]](/icons/layout.gif) | LR_resistance_in_vavilov_collection.pdf | 2018-12-19 06:26 | 5.4M | |
![[ ]](/icons/layout.gif) | UK_landrace_conservation_strategy.pdf | 2018-12-12 12:47 | 2.6M | |
![[ ]](/icons/layout.gif) | welsh_journal_of_agriculture_volII.pdf | 2018-11-14 15:12 | 1.2M | |
![[ ]](/icons/layout.gif) | Commonbunt-its-prevention.pdf | 2018-11-13 21:15 | 587K | |
![[ ]](/icons/layout.gif) | wheat-meal-fermentation_test.pdf | 2018-11-08 14:42 | 3.1M | |
![[ ]](/icons/layout.gif) | spread of HYV wheat.pdf | 2018-11-02 18:56 | 5.8M | |
![[ ]](/icons/layout.gif) | Improvement_of_Cereals_Shirreff.pdf | 2018-11-02 17:38 | 1.9M | |
![[ ]](/icons/layout.gif) | listes_ble_meuniers_2018.pdf | 2018-10-02 14:31 | 938K | |
![[ ]](/icons/layout.gif) | g13_the_grain_storage_guide_-_2nd_edition.pdf | 2018-09-03 22:34 | 3.1M | |
![[ ]](/icons/layout.gif) | No.1 Pure Lines of Hen Gymro Wheat_WPBS_OCR.pdf | 2018-08-19 09:34 | 3.9M | |
![[ ]](/icons/layout.gif) | WPBS leaflet Series S No. 5_Hen_Gymro_OCR.pdf | 2018-07-31 11:23 | 963K | |
![[ ]](/icons/layout.gif) | Outcrossing in New Zealand wheats measured by occurrence of purple grain.pdf | 2018-07-26 12:13 | 676K | |
![[ ]](/icons/layout.gif) | purple_inheritance.pdf | 2018-07-26 11:57 | 585K | |
![[ ]](/icons/layout.gif) | Bread-making-quality-of-wheat_Europe.pdf | 2018-07-23 09:11 | 9.8M | |
![[ ]](/icons/layout.gif) | cereal_identification_archaelogical.pdf | 2018-06-24 09:40 | 6.0M | |
![[ ]](/icons/layout.gif) | Gliadin test hard red spring wheats.pdf | 2018-06-22 08:32 | 341K | |
![[ ]](/icons/layout.gif) | Relationship between yield and mineral nutrient concentrations in historical and modern spring wheat cultivars.pdf | 2018-06-16 09:06 | 600K | |
![[ ]](/icons/layout.gif) | Thorpe_mill.pdf | 2018-06-14 10:30 | 1.0M | |
![[ ]](/icons/layout.gif) | Bonfils-Cereales.pdf | 2018-05-05 19:26 | 8.9M | |
![[ ]](/icons/layout.gif) | Huby mill biodynamic article.pdf | 2018-05-03 16:43 | 1.4M | |
![[ ]](/icons/layout.gif) | wheat_identification_usda_1923.pdf | 2018-01-03 12:22 | 9.1M | |
![[ ]](/icons/layout.gif) | La repartition des varietes de Bles en France 1922.pdf | 2017-05-01 11:20 | 1.1M | |
![[ ]](/icons/layout.gif) | Wheat varieties and technological change in Europe 19th and 20th centuries.pdf | 2017-05-01 10:22 | 910K | |
![[ ]](/icons/layout.gif) | les_bles_cultives_par_Denaiffe.pdf | 2017-04-30 15:56 | 6.4M | |
![[IMG]](/icons/image2.gif) | evolucion-trigos-i.png | 2017-01-16 20:23 | 220K | |
![[ ]](/icons/layout.gif) | emmer in Navarre.pdf | 2016-10-28 09:45 | 141K | |
![[ ]](/icons/layout.gif) | Wheat Under Domestication.pdf | 2016-10-01 14:24 | 318K | |
![[ ]](/icons/layout.gif) | protein-actors-sustaining-arbuscular-mycorrhizal-symbiosis-underground-artists-break-the-silence.pdf | 2016-07-19 15:25 | 689K | |
![[ ]](/icons/layout.gif) | Rhizosphere_chemical_dialogues_plant.pdf | 2016-07-19 14:30 | 630K | |
![[ ]](/icons/layout.gif) | les bles Vilmorin.pdf | 2016-07-19 11:48 | 620K | |
![[ ]](/icons/layout.gif) | Grounded Guide to Gluten.pdf | 2016-06-20 14:52 | 591K | |
![[ ]](/icons/layout.gif) | Table of Wheat Varieties Grown in England during the 18th Century.pdf | 2016-06-20 14:52 | 215K | |
![[ ]](/icons/layout.gif) | Classification of wheat varieties grown in the United States in 1949.pdf | 2016-06-20 14:52 | 6.6M | |
![[ ]](/icons/unknown.gif) | Commonbunt-its-prevention.docx | 2016-06-20 14:46 | 932K | |
![[ ]](/icons/layout.gif) | french_crop_report_14.pdf | 2016-06-20 14:46 | 3.1M | |
![[ ]](/icons/layout.gif) | Some Agronomic and Chemical Traits of Blue Aleurone.pdf | 2016-06-20 14:45 | 377K | |
![[ ]](/icons/layout.gif) | The Case for Rejecting or Respecting the Staff of Life.pdf | 2016-06-20 14:45 | 107K | |
![[ ]](/icons/layout.gif) | Optimizing the bioactive potential of wheat bran by processing..pdf | 2016-06-20 14:45 | 555K | |
![[ ]](/icons/layout.gif) | Use of wheat gene resources with different grain colour in breeding.pdf | 2016-06-20 14:45 | 246K | |
![[ ]](/icons/layout.gif) | Effects of glyphosate on nitrogen fixation of free-living.pdf | 2016-06-20 14:45 | 255K | |
![[ ]](/icons/layout.gif) | Sustainability of UK - grown wheat for breadmaking.pdf | 2016-06-20 14:45 | 3.3M | |
![[ ]](/icons/layout.gif) | pre maturity amykase activity and HFN.pdf | 2016-06-20 14:44 | 3.7M | |
![[ ]](/icons/layout.gif) | Wheat Quality Breeding in Bulgaria.pdf | 2016-06-20 14:44 | 367K | |
![[ ]](/icons/layout.gif) | Genetic Improvement of Agronomic Traits of Winter Wheat Cultivars Released in France.pdf | 2016-06-20 14:44 | 92K | |
![[ ]](/icons/layout.gif) | Changes in bread-making quality attributes of bread wheat varieties cultivated in Spain during the 20th century.pdf | 2016-06-20 14:43 | 571K | |
![[ ]](/icons/layout.gif) | Gluten_A Balance of Gliadin and Glutenin.pdf | 2016-06-20 14:43 | 457K | |
![[ ]](/icons/layout.gif) | Historical shifts in the seed mineral micronutrient concentration of US hard red winter wheat germplasm.pdf | 2016-06-20 14:43 | 146K | |
![[ ]](/icons/layout.gif) | Evidence of decreasing mineral density in wheat grain over the last 160 years.pdf | 2016-06-20 14:43 | 864K | |
![[ ]](/icons/layout.gif) | wheat_hybridization_how_to.pdf | 2016-06-20 14:43 | 1.0M | |
![[ ]](/icons/layout.gif) | The dynamic behavior of storage organelles in developing cereal seeds.pdf | 2016-06-20 14:43 | 1.0M | |
![[ ]](/icons/layout.gif) | Changing Crop magnesium concentrations- Impact on human health.pdf | 2016-06-20 14:43 | 460K | |
![[ ]](/icons/layout.gif) | Sensory Characteristics of Whole Wheat Mineral Fortified Chapattis.pdf | 2016-06-20 14:43 | 105K | |
![[ ]](/icons/layout.gif) | Historical changes in grain yield and quality of Siberian wheat.pdf | 2016-06-20 14:42 | 208K | |
![[ ]](/icons/layout.gif) | Quality of Organically Produced Wheat.pdf | 2016-06-20 14:42 | 3.8M | |
![[ ]](/icons/layout.gif) | Hormonal signalling in cereal aleurone layer.pdf | 2016-06-20 14:42 | 3.7M | |
![[ ]](/icons/layout.gif) | The Importance of Lactic Acid Bacteria for Phytate Degradation.pdf | 2016-06-20 14:41 | 42K | |
![[ ]](/icons/layout.gif) | NABIM wheat allergy report.pdf | 2016-06-20 14:41 | 1.1M | |
![[ ]](/icons/layout.gif) | wheat origin in caspian iran.pdf | 2016-06-20 14:41 | 121K | |
![[ ]](/icons/layout.gif) | Dough quality of bread wheat lacking a-gliadins with celiac disease.pdf | 2016-06-20 14:41 | 709K | |
![[ ]](/icons/layout.gif) | Structure and functional properties of gluten.pdf | 2016-06-20 14:40 | 793K | |
![[ ]](/icons/layout.gif) | Presence of celiac disease epitopes in modern and old hexaploid.pdf | 2016-06-20 14:40 | 720K | |
![[ ]](/icons/layout.gif) | Gliadin peptides and coeliac disease.pdf | 2016-06-20 14:40 | 111K | |
![[ ]](/icons/layout.gif) | Mapping of gluten T-cell epitopes in the bread wheat ancesto....pdf | 2016-06-20 14:40 | 247K | |
![[ ]](/icons/layout.gif) | Larson___Fuller_Evolution_of_Animal_Domestication__proofs_-libre.pdf | 2016-06-20 14:40 | 522K | |
![[ ]](/icons/layout.gif) | The_Decline_of_the_Neolithic_and_the_Rise_of_Bronze_Age_Society-libre.pdf | 2016-06-20 14:40 | 302K | |
![[ ]](/icons/layout.gif) | Breeding of high quality wheat for organic agriculture.pdf | 2016-06-20 14:40 | 38K | |
![[ ]](/icons/layout.gif) | Highly Efficient Gluten Degradation.pdf | 2016-06-20 14:40 | 232K | |
![[ ]](/icons/layout.gif) | Nordic heritage varieties of cereals seminar.pdf | 2016-06-20 14:40 | 447K | |
![[ ]](/icons/layout.gif) | Utilisation de l’acide acétique (vinaigre) dans la lutte contre la carie du blé (Tilletia caries et foetida).pdf | 2016-06-20 14:38 | 143K | |
![[ ]](/icons/layout.gif) | The organic seed regulations framework in Europe – current status and recommendations for future development.pdf | 2016-06-20 14:36 | 478K | |
![[ ]](/icons/layout.gif) | effects of scalding flour on bread quality.pdf | 2015-06-30 09:30 | 258K | |
![[ ]](/icons/layout.gif) | ft-ble-brochure-complete_maj_juil2014.pdf | 2015-06-22 12:35 | 6.4M | |
![[ ]](/icons/layout.gif) | howard_2014.pdf | 2015-05-06 09:04 | 545K | |
![[IMG]](/icons/image2.gif) | scaring-birds.jpg | 2015-04-25 09:49 | 46K | |
![[ ]](/icons/layout.gif) | d-florent_mercier_bl__s_paysans1.pdf | 2015-03-29 10:08 | 26K | |
![[ ]](/icons/layout.gif) | The degradation of phytate by microbial and wheat phytases.pdf | 2015-03-25 17:09 | 179K | |
![[ ]](/icons/layout.gif) | Composición en gluteninas de alto peso molecular de variedades.pdf | 2015-03-16 12:45 | 454K | |
![[ ]](/icons/layout.gif) | Content of free amino groups during postharvest wheat and flour.pdf | 2015-03-14 15:57 | 1.1M | |
![[ ]](/icons/layout.gif) | Programmed cell death (PCD) an essential process of cereal seed development and germination.pdf | 2015-02-16 22:02 | 938K | |
![[ ]](/icons/layout.gif) | Patterns of Starchy Endosperm Acidification and Protease.pdf | 2015-02-16 21:50 | 366K | |
![[ ]](/icons/layout.gif) | Ecodyn_low_till_cultivation_and_sowing_techniques.pdf | 2015-02-16 15:13 | 3.5M | |
![[ ]](/icons/layout.gif) | Mineral Composition of Organically Grown Wheat Genotypes_Contribution to Daily Minerals Intake.pdf | 2015-02-16 14:06 | 269K | |
![[ ]](/icons/layout.gif) | Sourdough Technology—A Traditional Way.pdf | 2015-02-16 12:35 | 373K | |
![[ ]](/icons/layout.gif) | plant breeding in Nazi Germany.pdf | 2015-02-04 08:39 | 190K | |
![[ ]](/icons/layout.gif) | Increasing prevalence of coeliac disease over time.pdf | 2015-01-26 15:38 | 146K | |
![[ ]](/icons/layout.gif) | New Clues in Celiac Disease Epidemiology.pdf | 2015-01-26 15:31 | 324K | |
![[ ]](/icons/layout.gif) | Coeliac-safe wheat.pdf | 2015-01-19 16:35 | 2.7M | |
![[ ]](/icons/layout.gif) | trueloaf22_nordic_saga.pdf | 2015-01-18 18:50 | 672K | |
![[ ]](/icons/layout.gif) | Swedish cereals report_Hans_Larsson.pdf | 2015-01-13 16:34 | 47K | |
![[ ]](/icons/layout.gif) | Disinfection of vegetable seed by treatment with basic substances.pdf | 2014-11-19 12:01 | 78K | |
![[ ]](/icons/layout.gif) | Organic seed treatment possibilities.pdf | 2014-11-19 11:51 | 269K | |
![[ ]](/icons/layout.gif) | Effect of seed treatment with organic acids on the control of common bunt (Tilletia tritici and T. laevis) in wheat.pdf | 2014-11-19 11:47 | 1.2M | |
![[ ]](/icons/layout.gif) | ACETIC ACID AS A SOIL DISINFECTANT.pdf | 2014-11-18 17:01 | 538K | |
![[ ]](/icons/layout.gif) | BSA Vinegar February 2014.pdf | 2014-11-17 21:19 | 796K | |
![[ ]](/icons/layout.gif) | REVIEW OF POTENTIAL SEED TREATMENTS FOR USE IN ORGANIC CEREALS.pdf | 2014-11-17 15:53 | 97K | |
![[ ]](/icons/layout.gif) | Effect of seed treatment with acetic acid for control of seed borne diseases.pdf | 2014-11-16 18:16 | 4.1M | |
![[ ]](/icons/layout.gif) | Strategies for Regulation of Seed Borne Diseases in Organic Farming.pdf | 2014-11-16 15:05 | 201K | |
![[ ]](/icons/layout.gif) | Cereal varieties for organic production- Developing a participatory approach to seed production and varietal selection.pdf | 2014-11-16 14:17 | 559K | |
![[ ]](/icons/layout.gif) | Review of UK research and development for organic food and farming.pdf | 2014-11-16 13:59 | 175K | |
![[ ]](/icons/layout.gif) | HGCA - European case study on seed treatments and seed-borne disease control using seed treatments.pdf | 2014-11-16 13:22 | 239K | |
![[ ]](/icons/layout.gif) | The organic seed regulations framework in Europe – current status and recommendations for future development.pdf | 2014-11-16 13:09 | 478K | |
![[ ]](/icons/layout.gif) | Control of Common Bunt in Organic Wheat.pdf | 2014-11-12 10:45 | 439K | |
![[ ]](/icons/layout.gif) | Production of organic seed in UK - report 2000.pdf | 2014-11-11 23:13 | 1.2M | |
![[ ]](/icons/layout.gif) | zurn 150 plot combine.pdf | 2014-11-04 12:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Mineral Composition of Organically Grown Wheat Genotypes- Contribution to Daily Minerals Intake.pdf | 2014-10-30 20:04 | 302K | |
![[ ]](/icons/layout.gif) | Optimization of antinutritional factors from germinated wheat.pdf | 2014-10-25 10:57 | 426K | |
![[ ]](/icons/layout.gif) | wheat_gluten_genes_inra.pdf | 2014-10-14 08:34 | 2.8M | |
![[ ]](/icons/layout.gif) | tillecur instructions.pdf | 2014-10-06 20:16 | 139K | |
![[ ]](/icons/layout.gif) | Etiquette Tillecur.pdf | 2014-10-06 15:05 | 23K | |
![[ ]](/icons/unknown.gif) | Etiquette Tillecur.doc | 2014-10-06 15:03 | 147K | |
![[ ]](/icons/layout.gif) | Vilmorin_classification_ble_1851.pdf | 2014-09-10 23:20 | 2.1M | |
![[ ]](/icons/layout.gif) | zeleny_test.pdf | 2014-07-20 16:50 | 903K | |
![[ ]](/icons/layout.gif) | hen_gym_ref.pdf | 2014-07-13 16:51 | 1.0M | |
![[ ]](/icons/layout.gif) | prediction_in_plant_breeding.pdf | 2014-07-12 14:41 | 1.3M | |
![[ ]](/icons/layout.gif) | World Wheat Facts and Trends - CIMMYT.pdf | 2014-07-11 16:57 | 3.3M | |
![[ ]](/icons/layout.gif) | genes_and_gluten.pdf | 2014-07-11 16:57 | 2.8M | |
![[ ]](/icons/layout.gif) | fascists and wheat.pdf | 2014-07-11 16:57 | 2.0M | |
![[ ]](/icons/layout.gif) | gene_markers_in_wheat_breeding.pdf | 2014-07-11 16:56 | 480K | |
![[ ]](/icons/unknown.gif) | Seed_Catalogues_c.1920-1950.xlsx | 2014-07-11 16:55 | 41K | |
![[ ]](/icons/layout.gif) | EvoBreeding-Proceedings.2013.pdf | 2014-07-06 16:09 | 761K | |
![[ ]](/icons/layout.gif) | Vilmorin_classification_ble_1895.pdf | 2014-07-05 18:13 | 4.3M | |
![[ ]](/icons/layout.gif) | Geographic Distribution of Common and Dwarf Bunt Resistance.pdf | 2014-07-05 18:12 | 391K | |
![[ ]](/icons/layout.gif) | Australian_wheat_19thC.pdf | 2014-07-04 07:19 | 2.7M | |
![[ ]](/icons/layout.gif) | gardeners_chronicle_april_22_1865.pdf | 2014-07-03 17:40 | 457K | |
![[ ]](/icons/layout.gif) | Collaborative Plant Breeding for Organic Agricultural Systems.pdf | 2014-06-30 16:55 | 2.4M | |
![[ ]](/icons/layout.gif) | Evolutionary_Breeding-Proceedings.2013.pdf | 2014-06-30 16:55 | 761K | |
![[ ]](/icons/layout.gif) | waldron_wheat.pdf | 2014-06-27 11:28 | 4.0M | |
![[ ]](/icons/layout.gif) | welsh_herbage_catalogue_1948.pdf | 2014-06-26 19:23 | 4.6M | |
![[ ]](/icons/layout.gif) | Enhancing diversity in UK wheat through a public sector pre breeding programme.pdf | 2014-05-27 10:29 | 731K | |
![[ ]](/icons/layout.gif) | watkins_stem_rust resistance.pdf | 2014-05-27 10:23 | 94K | |
![[TXT]](/icons/text.gif) | Mining the Watkins collection for eyespot resistance.htm | 2014-05-27 10:21 | 12K | |
![[ ]](/icons/layout.gif) | watkins_collection.pdf | 2014-05-27 10:19 | 2.2M | |
![[ ]](/icons/layout.gif) | Sr42 mapping.pdf | 2014-05-26 16:25 | 288K | |
![[ ]](/icons/layout.gif) | stem rust virulence sr24 within TTKS_2006.pdf | 2014-05-26 15:51 | 139K | |
![[ ]](/icons/layout.gif) | stem_rust_threat_2008.pdf | 2014-05-26 11:53 | 1.2M | |
![[ ]](/icons/layout.gif) | GeneSymbols_2013.pdf | 2014-05-26 11:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Notes_on_wheat_diseases_Portugal_1930.pdf | 2014-05-22 13:05 | 529K | |
![[ ]](/icons/layout.gif) | wheat_gene_symbols_2012.pdf | 2014-05-18 15:22 | 273K | |
![[ ]](/icons/layout.gif) | L_R_Waldron.pdf | 2014-05-14 12:20 | 938K | |
![[ ]](/icons/layout.gif) | will stem rust destroy world wheat.pdf | 2014-05-14 11:33 | 855K | |
![[ ]](/icons/layout.gif) | Genome Plasticity a Key Factor for wheat.pdf | 2014-04-23 16:09 | 318K | |
![[ ]](/icons/layout.gif) | Transgenerational defense induction and epigentic inheritance in plants.pdf | 2014-04-23 13:31 | 562K | |
![[ ]](/icons/layout.gif) | Holeski-Jander-Agrawal-2012.TREE_.pdf | 2014-04-23 13:19 | 562K | |
![[ ]](/icons/layout.gif) | whitman-and-agrawal-2009-Ch_1-Phenotypic-Plasticity-of-Insects.pdf | 2014-04-23 11:25 | 763K | |
![[ ]](/icons/unknown.gif) | finnish_rye_history.doc | 2014-04-13 15:07 | 30K | |
![[ ]](/icons/layout.gif) | Microsatellite Marker Analysis of Resistance to Common Bunt in several Wheat Genotypes.pdf | 2014-03-28 19:52 | 1.2M | |
![[ ]](/icons/layout.gif) | new bunt races.pdf | 2014-03-28 19:52 | 201K | |
![[ ]](/icons/layout.gif) | Wheat screening for resistance to common bunt and dwarf bunt.pdf | 2014-03-28 18:08 | 717K | |
![[ ]](/icons/layout.gif) | Dialnet-BiodiversityAndSecurity-4229919.pdf | 2014-03-25 14:23 | 1.1M | |
![[ ]](/icons/layout.gif) | Instant appropriation–Heinz Brücher and the SS botanical collecting commando.pdf | 2014-03-24 11:48 | 36K | |
![[ ]](/icons/layout.gif) | Nazi_biopirates.pdf | 2014-03-24 08:21 | 806K | |
![[ ]](/icons/layout.gif) | Le Blé meunier d’Apt.pdf | 2014-03-23 22:47 | 660K | |
![[ ]](/icons/layout.gif) | smut resistance_briggs_1933.pdf | 2014-03-10 00:22 | 523K | |
![[ ]](/icons/layout.gif) | POTENTIALLY NEW SOURCES OF GENES.pdf | 2014-03-10 00:22 | 141K | |
![[ ]](/icons/layout.gif) | Inheritance of resistance to common.pdf | 2014-03-10 00:22 | 131K | |
![[ ]](/icons/layout.gif) | wheat_growing_in_Russia_1900.pdf | 2014-02-11 12:07 | 1.2M | |
![[ ]](/icons/layout.gif) | Report_of_a_Working_Group_on_Wheat_2001.pdf | 2014-02-09 21:13 | 1.4M | |
![[ ]](/icons/layout.gif) | Crop-processing of hulled wheats.pdf | 2014-01-06 18:57 | 78K | |
![[ ]](/icons/layout.gif) | Vavilov_and_his_institute.pdf | 2014-01-06 18:37 | 8.3M | |
![[ ]](/icons/layout.gif) | Hulled wheats in Spain_history of minor cereals.pdf | 2014-01-06 18:37 | 75K | |
![[ ]](/icons/layout.gif) | On Phytic Acid.pdf | 2014-01-06 18:37 | 2.3M | |
![[ ]](/icons/layout.gif) | The historical perspective of dryland agriculture - catalonia.pdf | 2014-01-06 18:36 | 261K | |
![[ ]](/icons/layout.gif) | hulled_wheat_review_1995.pdf | 2014-01-06 18:36 | 3.3M | |
![[ ]](/icons/layout.gif) | VIR_collection_through_Leningrad_siege.pdf | 2013-11-24 17:08 | 85K | |
![[ ]](/icons/layout.gif) | How_much_wheat_is_in_spelt_flour.pdf | 2013-11-22 18:39 | 347K | |
![[ ]](/icons/layout.gif) | restitution_finale_sminaire_de_travail_paysbl_avril_2010.pdf | 2013-11-05 22:47 | 1.8M | |
![[ ]](/icons/layout.gif) | vavilov_in_asturias.pdf | 2013-11-05 16:43 | 207K | |
![[ ]](/icons/layout.gif) | Composite Cross Populations research paper.pdf | 2013-08-17 14:41 | 271K | |
![[ ]](/icons/layout.gif) | sowing 2012_13.pdf | 2013-07-08 08:49 | 151K | |
![[ ]](/icons/layout.gif) | The Origin of Spelt and Free-Threshing.pdf | 2013-05-24 13:30 | 808K | |
![[ ]](/icons/unknown.gif) | issues around the digestion of bread by humans.docx | 2013-05-13 01:28 | 19K | |
![[ ]](/icons/layout.gif) | enzyme activity in wheat.pdf | 2013-05-06 11:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | nan.swf | 2013-05-02 23:12 | 56K | |
![[ ]](/icons/layout.gif) | Domestication_genetics_wheat.pdf | 2012-12-19 14:31 | 828K | |
![[ ]](/icons/layout.gif) | celiac disease epitopes in modern and old hexaploid.pdf | 2012-12-17 18:42 | 720K | |
![[ ]](/icons/layout.gif) | french_crop_report_12.pdf | 2012-11-24 14:59 | 1.3M | |
![[ ]](/icons/layout.gif) | madeira_wheat_paper.pdf | 2012-11-18 17:13 | 273K | |
![[ ]](/icons/layout.gif) | milling_health_and_safety.pdf | 2012-06-14 10:10 | 403K | |
![[ ]](/icons/layout.gif) | bokashicomposting1.pdf | 2012-04-08 21:30 | 751K | |
![[ ]](/icons/layout.gif) | How to Cultivate Indigenous Microorganisms.pdf | 2012-04-08 20:40 | 660K | |
![[ ]](/icons/layout.gif) | phytase activity.pdf | 2012-04-06 19:19 | 400K | |
![[ ]](/icons/layout.gif) | Bran as a brown gold.pdf | 2012-04-06 19:13 | 284K | |
![[ ]](/icons/layout.gif) | thresher.pdf | 2012-03-26 14:47 | 1.3M | |
![[ ]](/icons/layout.gif) | madeira_wheat.pdf | 2012-01-12 21:30 | 3.0M | |
![[ ]](/icons/layout.gif) | east_west.pdf | 2011-12-27 23:35 | 1.3M | |
![[ ]](/icons/layout.gif) | Brockwell Bake harvest lunch public.pdf | 2011-10-06 05:04 | 123K | |
![[ ]](/icons/layout.gif) | #5 Brockwell Bake letter of Endoresement JIC.pdf | 2011-09-29 10:31 | 17K | |
![[ ]](/icons/layout.gif) | Brockwell Bake harvest lunch.pdf | 2011-09-29 09:51 | 120K | |
![[ ]](/icons/layout.gif) | heritage_wheats_expo.pdf | 2011-09-15 05:51 | 899K | |
![[ ]](/icons/unknown.gif) | bunt_treatment.PDF | 2011-08-09 22:13 | 381K | |
![[ ]](/icons/layout.gif) | anti_bunt_fr.pdf | 2011-08-09 12:04 | 1.7M | |
![[ ]](/icons/layout.gif) | bunt_resitance_fr.pdf | 2011-08-09 11:47 | 48K | |
![[ ]](/icons/layout.gif) | nigel.pdf | 2011-06-25 17:20 | 286K | |
![[ ]](/icons/layout.gif) | organic_seed_treatments.pdf | 2011-06-20 18:32 | 97K | |
![[ ]](/icons/layout.gif) | Bonfils - Winter Wheat Physiology.pdf | 2011-06-13 18:42 | 190K | |
![[ ]](/icons/layout.gif) | Bonfils - Nat Ag Winter Wheat in N Europe.pdf | 2011-06-13 18:42 | 28K | |
![[ ]](/icons/layout.gif) | wheat_cultivar_breeding.pdf | 2011-06-09 05:43 | 3.6M | |
![[ ]](/icons/layout.gif) | sd_stress_article.pdf | 2011-05-18 20:43 | 564K | |
![[ ]](/icons/layout.gif) | blue cone.pdf | 2011-05-08 12:58 | 35K | |
![[ ]](/icons/layout.gif) | BBA_appendix.pdf | 2011-04-27 20:20 | 5.6M | |
![[IMG]](/icons/image2.gif) | grain.jpg | 2011-04-25 18:32 | 183K | |
![[ ]](/icons/layout.gif) | wheat_gluten.pdf | 2011-04-25 16:40 | 793K | |
![[ ]](/icons/layout.gif) | BBA_sourdough_recipe.pdf | 2011-03-11 02:15 | 286K | |
![[ ]](/icons/layout.gif) | central_Italy_landrace_wheats.pdf | 2011-03-09 18:54 | 1.5M | |
![[ ]](/icons/layout.gif) | landrace_selection_and_maintenance.pdf | 2011-02-28 22:53 | 146K | |
![[ ]](/icons/layout.gif) | landrace_selection_2.pdf | 2011-02-28 22:53 | 126K | |
![[ ]](/icons/layout.gif) | landrace.pdf | 2011-02-28 22:53 | 120K | |
![[ ]](/icons/layout.gif) | veg_landrace.pdf | 2011-02-28 22:53 | 715K | |
![[ ]](/icons/layout.gif) | trueloaf_issue6.pdf | 2011-02-28 22:52 | 1.1M | |
![[ ]](/icons/layout.gif) | ancient_plant_DNA.pdf | 2011-02-28 22:37 | 228K | |
![[ ]](/icons/layout.gif) | alu_madeira_wheat.pdf | 2011-02-28 22:37 | 616K | |
![[ ]](/icons/layout.gif) | harvesters_diet.pdf | 2011-02-28 22:37 | 1.4M | |
![[ ]](/icons/layout.gif) | wolfe_etal.pdf | 2011-02-28 22:37 | 384K | |
![[ ]](/icons/layout.gif) | vilmorin_intro.pdf | 2011-02-28 22:36 | 337K | |
![[ ]](/icons/layout.gif) | UK_inventory.pdf | 2011-02-28 22:36 | 778K | |
![[ ]](/icons/layout.gif) | UK_diet_19C.pdf | 2011-02-28 22:36 | 1.5M | |
|